C46H32N2O2 — CID 166436669
7,16-diazanonacyclo[28.2.2.22,5.26,9.210,13.214,17.218,21.222,25.226,29]octatetraconta-1(32),2(48),3,5(47),6,8,11,14,16,18,20,22,24,26,28,30,33,35,37,39,41,43,45-tricosaene-10,13-diol (PubChem CID 166436669) has the molecular formula C46H32N2O2 and a molecular weight of 644.77 g/mol. Its IUPAC name is 7,16-diazanonacyclo[28.2.2.22,5.26,9.210,13.214,17.218,21.222,25.226,29]octatetraconta-1(32),2(48),3,5(47),6,8,11,14,16,18,20,22,24,26,28,30,33,35,37,39,41,43,45-tricosaene-10,13-diol.
| Compound Name | 7,16-diazanonacyclo[28.2.2.22,5.26,9.210,13.214,17.218,21.222,25.226,29]octatetraconta-1(32),2(48),3,5(47),6,8,11,14,16,18,20,22,24,26,28,30,33,35,37,39,41,43,45-tricosaene-10,13-diol |
|---|---|
| PubChem CID | 166436669 |
| Molecular Formula | C46H32N2O2 |
| Molecular Weight | 644.77 g/mol |
| Exact Mass | 644.25 |
| IUPAC Name | 7,16-diazanonacyclo[28.2.2.22,5.26,9.210,13.214,17.218,21.222,25.226,29]octatetraconta-1(32),2(48),3,5(47),6,8,11,14,16,18,20,22,24,26,28,30,33,35,37,39,41,43,45-tricosaene-10,13-diol |
| SMILES | OC12C=CC(O)(C=C1)c1ccc(nc1)-c1ccc(cc1)-c1ccc(cc1)-c1ccc(cc1)-c1ccc(cc1)-c1ccc(cc1)-c1ccc2cn1 |
| InChI | InChI=1S/C46H32N2O2/c49-45-25-27-46(50,28-26-45)42-22-24-44(48-30-42)40-19-15-38(16-20-40)36-11-7-34(8-12-36)32-2-1-31(3-4-32)33-5-9-35(10-6-33)37-13-17-39(18-14-37)43-23-21-41(45)29-47-43/h1-30,49-50H |
| InChIKey | DEWOPHMDODFJBH-UHFFFAOYSA-N |
| XLogP | 9.99 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.77 |
| LogP ≤ 5 | 9.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|