About ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate
ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate (PubChem CID 166436989) has the molecular formula C15H18F3NO2
and a molecular weight of 301.31 g/mol. Its IUPAC name is ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate.
Molecular Properties
| Compound Name | ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate |
| PubChem CID | 166436989 |
| Molecular Formula | C15H18F3NO2 |
| Molecular Weight | 301.31 g/mol |
| Exact Mass | 301.13 |
| IUPAC Name | ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate |
| SMILES | CCOC(=O)/C=C(/Nc1ccc(C(C)C)cc1)C(F)(F)F |
| InChI | InChI=1S/C15H18F3NO2/c1-4-21-14(20)9-13(15(16,17)18)19-12-7-5-11(6-8-12)10(2)3/h5-10,19H,4H2,1-3H3/b13-9+ |
| InChIKey | NINPZBZPSNRQMV-UKTHLTGXSA-N |
| XLogP | 4.23 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.31 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate?
The IUPAC name of ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate (CID 166436989) is ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate.
What is the SMILES notation for ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate?
The canonical SMILES for ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate is CCOC(=O)/C=C(/Nc1ccc(C(C)C)cc1)C(F)(F)F.
What is the InChIKey of ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate?
The InChIKey is NINPZBZPSNRQMV-UKTHLTGXSA-N. The full InChI is InChI=1S/C15H18F3NO2/c1-4-21-14(20)9-13(15(16,17)18)19-12-7-5-11(6-8-12)10(2)3/h5-10,19H,4H2,1-3H3/b13-9+.
What are the key properties of ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate?
ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate has a molecular weight of 301.31 g/mol, XLogP of 4.23, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (E)-4,4,4-trifluoro-3-(4-propan-2-ylanilino)but-2-enoate is sourced from PubChem (CID 166436989), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).