About [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate
[(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate (PubChem CID 166437160) has the molecular formula C18H27NO2
and a molecular weight of 289.42 g/mol. Its IUPAC name is [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate |
| PubChem CID | 166437160 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate |
| SMILES | C[C@H]([C@@H](OC(=O)C1CCCCC1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C18H27NO2/c1-14(19(2)3)17(15-10-6-4-7-11-15)21-18(20)16-12-8-5-9-13-16/h4,6-7,10-11,14,16-17H,5,8-9,12-13H2,1-3H3/t14-,17-/m1/s1 |
| InChIKey | JDENVEMBJNTFGK-RHSMWYFYSA-N |
| XLogP | 3.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate?
The IUPAC name of [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate (CID 166437160) is [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate.
What is the SMILES notation for [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate?
The canonical SMILES for [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate is C[C@H]([C@@H](OC(=O)C1CCCCC1)c1ccccc1)N(C)C.
What is the InChIKey of [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate?
The InChIKey is JDENVEMBJNTFGK-RHSMWYFYSA-N. The full InChI is InChI=1S/C18H27NO2/c1-14(19(2)3)17(15-10-6-4-7-11-15)21-18(20)16-12-8-5-9-13-16/h4,6-7,10-11,14,16-17H,5,8-9,12-13H2,1-3H3/t14-,17-/m1/s1.
What are the key properties of [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate?
[(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate has a molecular weight of 289.42 g/mol, XLogP of 3.80, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate is sourced from PubChem (CID 166437160), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).