C18H27NO2 — CID 166437160
[(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate (PubChem CID 166437160) has the molecular formula C18H27NO2 and a molecular weight of 289.42 g/mol. Its IUPAC name is [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate.
| Compound Name | [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate |
|---|---|
| PubChem CID | 166437160 |
| Molecular Formula | C18H27NO2 |
| Molecular Weight | 289.42 g/mol |
| Exact Mass | 289.20 |
| IUPAC Name | [(1S,2R)-2-(dimethylamino)-1-phenylpropyl] cyclohexanecarboxylate |
| SMILES | C[C@H]([C@@H](OC(=O)C1CCCCC1)c1ccccc1)N(C)C |
| InChI | InChI=1S/C18H27NO2/c1-14(19(2)3)17(15-10-6-4-7-11-15)21-18(20)16-12-8-5-9-13-16/h4,6-7,10-11,14,16-17H,5,8-9,12-13H2,1-3H3/t14-,17-/m1/s1 |
| InChIKey | JDENVEMBJNTFGK-RHSMWYFYSA-N |
| XLogP | 3.80 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.42 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |