About (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide
(4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide (PubChem CID 166437201) has the molecular formula C7H15NO3S
and a molecular weight of 193.27 g/mol. Its IUPAC name is (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide.
Analyze (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide?
The IUPAC name of (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide (CID 166437201) is (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide.
What is the SMILES notation for (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide?
The canonical SMILES for (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide is C[C@@H]1OS(=O)(=O)N[C@@H]1C(C)(C)C.
What is the InChIKey of (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide?
The InChIKey is IZDFGHPHNYPSGE-WDSKDSINSA-N. The full InChI is InChI=1S/C7H15NO3S/c1-5-6(7(2,3)4)8-12(9,10)11-5/h5-6,8H,1-4H3/t5-,6-/m0/s1.
What are the key properties of (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide?
(4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide has a molecular weight of 193.27 g/mol, XLogP of 0.65, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R,5S)-4-tert-butyl-5-methyloxathiazolidine 2,2-dioxide is sourced from PubChem (CID 166437201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).