About [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate
[2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate (PubChem CID 166437444) has the molecular formula C29H43NO3Si
and a molecular weight of 481.75 g/mol. Its IUPAC name is [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate.
Molecular Properties
| Compound Name | [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate |
| PubChem CID | 166437444 |
| Molecular Formula | C29H43NO3Si |
| Molecular Weight | 481.75 g/mol |
| Exact Mass | 481.30 |
| IUPAC Name | [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate |
| SMILES | CCC/C=C/CN(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C29H43NO3Si/c1-8-9-10-17-22-30(33-27(31)28(2,3)4)23-24-32-34(29(5,6)7,25-18-13-11-14-19-25)26-20-15-12-16-21-26/h10-21H,8-9,22-24H2,1-7H3/b17-10+ |
| InChIKey | AQTZIBOLSWVCRA-LICLKQGHSA-N |
| XLogP | 5.73 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 481.75 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate?
The IUPAC name of [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate (CID 166437444) is [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate.
What is the SMILES notation for [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate?
The canonical SMILES for [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate is CCC/C=C/CN(CCO[Si](c1ccccc1)(c1ccccc1)C(C)(C)C)OC(=O)C(C)(C)C.
What is the InChIKey of [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate?
The InChIKey is AQTZIBOLSWVCRA-LICLKQGHSA-N. The full InChI is InChI=1S/C29H43NO3Si/c1-8-9-10-17-22-30(33-27(31)28(2,3)4)23-24-32-34(29(5,6)7,25-18-13-11-14-19-25)26-20-15-12-16-21-26/h10-21H,8-9,22-24H2,1-7H3/b17-10+.
What are the key properties of [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate?
[2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate has a molecular weight of 481.75 g/mol, XLogP of 5.73, 11 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [2-[tert-butyl(diphenyl)silyl]oxyethyl-[(E)-hex-2-enyl]amino] 2,2-dimethylpropanoate is sourced from PubChem (CID 166437444), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).