C46H71LiO — CID 166437497
lithium;1,5-di(propan-2-yl)-2,4-bis[2,4,6-tri(propan-2-yl)phenyl]benzene-3-ide;ethoxyethane (PubChem CID 166437497) has the molecular formula C46H71LiO and a molecular weight of 647.01 g/mol. Its IUPAC name is lithium;1,5-di(propan-2-yl)-2,4-bis[2,4,6-tri(propan-2-yl)phenyl]benzene-3-ide;ethoxyethane.
| Compound Name | lithium;1,5-di(propan-2-yl)-2,4-bis[2,4,6-tri(propan-2-yl)phenyl]benzene-3-ide;ethoxyethane |
|---|---|
| PubChem CID | 166437497 |
| Molecular Formula | C46H71LiO |
| Molecular Weight | 647.01 g/mol |
| Exact Mass | 646.57 |
| IUPAC Name | lithium;1,5-di(propan-2-yl)-2,4-bis[2,4,6-tri(propan-2-yl)phenyl]benzene-3-ide;ethoxyethane |
| SMILES | CC(C)c1cc(C(C)C)c(-c2[c-]c(-c3c(C(C)C)cc(C(C)C)cc3C(C)C)c(C(C)C)cc2C(C)C)c(C(C)C)c1.CCOCC.[Li+] |
| InChI | InChI=1S/C42H61.C4H10O.Li/c1-23(2)31-17-35(27(9)10)41(36(18-31)28(11)12)39-22-40(34(26(7)8)21-33(39)25(5)6)42-37(29(13)14)19-32(24(3)4)20-38(42)30(15)16;1-3-5-4-2;/h17-21,23-30H,1-16H3;3-4H2,1-2H3;/q-1;;+1 |
| InChIKey | XBEBEXXLELGVBO-UHFFFAOYSA-N |
| XLogP | 11.85 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 647.01 |
| LogP ≤ 5 | 11.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|