C11H13F3N4O2 — CID 166437569
1,3,7-trimethyl-8-(3,3,3-trifluoroprop-1-en-2-yl)-4,5-dihydropurine-2,6-dione (PubChem CID 166437569) has the molecular formula C11H13F3N4O2 and a molecular weight of 290.25 g/mol. Its IUPAC name is 1,3,7-trimethyl-8-(3,3,3-trifluoroprop-1-en-2-yl)-4,5-dihydropurine-2,6-dione.
| Compound Name | 1,3,7-trimethyl-8-(3,3,3-trifluoroprop-1-en-2-yl)-4,5-dihydropurine-2,6-dione |
|---|---|
| PubChem CID | 166437569 |
| Molecular Formula | C11H13F3N4O2 |
| Molecular Weight | 290.25 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1,3,7-trimethyl-8-(3,3,3-trifluoroprop-1-en-2-yl)-4,5-dihydropurine-2,6-dione |
| SMILES | C=C(C1=NC2C(C(=O)N(C)C(=O)N2C)N1C)C(F)(F)F |
| InChI | InChI=1S/C11H13F3N4O2/c1-5(11(12,13)14)7-15-8-6(16(7)2)9(19)18(4)10(20)17(8)3/h6,8H,1H2,2-4H3 |
| InChIKey | TYRRGVORMRBJCS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 56.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.25 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |