C14H22O2 — CID 166438055
(2aS,4aS,7aS,7bR)-2a-hydroxy-6,6,7b-trimethyl-2,3,4,4a,7,7a-hexahydro-1H-cyclobuta[e]inden-5-one (PubChem CID 166438055) has the molecular formula C14H22O2 and a molecular weight of 222.33 g/mol. Its IUPAC name is (2aS,4aS,7aS,7bR)-2a-hydroxy-6,6,7b-trimethyl-2,3,4,4a,7,7a-hexahydro-1H-cyclobuta[e]inden-5-one.
| Compound Name | (2aS,4aS,7aS,7bR)-2a-hydroxy-6,6,7b-trimethyl-2,3,4,4a,7,7a-hexahydro-1H-cyclobuta[e]inden-5-one |
|---|---|
| PubChem CID | 166438055 |
| Molecular Formula | C14H22O2 |
| Molecular Weight | 222.33 g/mol |
| Exact Mass | 222.16 |
| IUPAC Name | (2aS,4aS,7aS,7bR)-2a-hydroxy-6,6,7b-trimethyl-2,3,4,4a,7,7a-hexahydro-1H-cyclobuta[e]inden-5-one |
| SMILES | CC1(C)C[C@H]2[C@H](CC[C@]3(O)CC[C@]23C)C1=O |
| InChI | InChI=1S/C14H22O2/c1-12(2)8-10-9(11(12)15)4-5-14(16)7-6-13(10,14)3/h9-10,16H,4-8H2,1-3H3/t9-,10-,13+,14-/m0/s1 |
| InChIKey | JPEKEWLMRJGTFI-ZNIXKSQXSA-N |
| XLogP | 2.54 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.33 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |