C34H42N2O2S — CID 166438391
N-[(Z)-(3-cyclohexyl-1-naphthalen-2-ylprop-2-ynylidene)amino]-2,4,6-tri(propan-2-yl)benzenesulfonamide (PubChem CID 166438391) has the molecular formula C34H42N2O2S and a molecular weight of 542.79 g/mol. Its IUPAC name is N-[(Z)-(3-cyclohexyl-1-naphthalen-2-ylprop-2-ynylidene)amino]-2,4,6-tri(propan-2-yl)benzenesulfonamide.
| Compound Name | N-[(Z)-(3-cyclohexyl-1-naphthalen-2-ylprop-2-ynylidene)amino]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 166438391 |
| Molecular Formula | C34H42N2O2S |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 542.30 |
| IUPAC Name | N-[(Z)-(3-cyclohexyl-1-naphthalen-2-ylprop-2-ynylidene)amino]-2,4,6-tri(propan-2-yl)benzenesulfonamide |
| SMILES | CC(C)c1cc(C(C)C)c(S(=O)(=O)N/N=C(\C#CC2CCCCC2)c2ccc3ccccc3c2)c(C(C)C)c1 |
| InChI | InChI=1S/C34H42N2O2S/c1-23(2)30-21-31(24(3)4)34(32(22-30)25(5)6)39(37,38)36-35-33(19-16-26-12-8-7-9-13-26)29-18-17-27-14-10-11-15-28(27)20-29/h10-11,14-15,17-18,20-26,36H,7-9,12-13H2,1-6H3/b35-33+ |
| InChIKey | QUAQMPLIMYXGFQ-LAPDZXRHSA-N |
| XLogP | 8.48 |
| TPSA | 58.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 8.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|