About (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile
(Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile (PubChem CID 166438409) has the molecular formula C14H19NO
and a molecular weight of 217.31 g/mol. Its IUPAC name is (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile.
Molecular Properties
| Compound Name | (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile |
| PubChem CID | 166438409 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile |
| SMILES | CCCCC#C/C=C(/C#N)C(=O)C(C)(C)C |
| InChI | InChI=1S/C14H19NO/c1-5-6-7-8-9-10-12(11-15)13(16)14(2,3)4/h10H,5-7H2,1-4H3/b12-10- |
| InChIKey | FLDGUHMNMTZEHF-BENRWUELSA-N |
| XLogP | 3.25 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile?
The IUPAC name of (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile (CID 166438409) is (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile.
What is the SMILES notation for (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile?
The canonical SMILES for (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile is CCCCC#C/C=C(/C#N)C(=O)C(C)(C)C.
What is the InChIKey of (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile?
The InChIKey is FLDGUHMNMTZEHF-BENRWUELSA-N. The full InChI is InChI=1S/C14H19NO/c1-5-6-7-8-9-10-12(11-15)13(16)14(2,3)4/h10H,5-7H2,1-4H3/b12-10-.
What are the key properties of (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile?
(Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile has a molecular weight of 217.31 g/mol, XLogP of 3.25, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (Z)-2-(2,2-dimethylpropanoyl)non-2-en-4-ynenitrile is sourced from PubChem (CID 166438409), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).