About zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one
zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one (PubChem CID 166438573) has the molecular formula C8H14F4N2OZn
and a molecular weight of 295.59 g/mol. Its IUPAC name is zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one.
Molecular Properties
| Compound Name | zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one |
| PubChem CID | 166438573 |
| Molecular Formula | C8H14F4N2OZn |
| Molecular Weight | 295.59 g/mol |
| Exact Mass | 294.03 |
| IUPAC Name | zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one |
| SMILES | CN1CCCN(C)C1=O.F[CH-]F.F[CH-]F.[Zn+2] |
| InChI | InChI=1S/C6H12N2O.2CHF2.Zn/c1-7-4-3-5-8(2)6(7)9;2*2-1-3;/h3-5H2,1-2H3;2*1H;/q;2*-1;+2 |
| InChIKey | FMEWDNKOYNDTKX-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 23.55 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.59 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one?
The IUPAC name of zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one (CID 166438573) is zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one.
What is the SMILES notation for zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one?
The canonical SMILES for zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one is CN1CCCN(C)C1=O.F[CH-]F.F[CH-]F.[Zn+2].
What is the InChIKey of zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one?
The InChIKey is FMEWDNKOYNDTKX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12N2O.2CHF2.Zn/c1-7-4-3-5-8(2)6(7)9;2*2-1-3;/h3-5H2,1-2H3;2*1H;/q;2*-1;+2.
What are the key properties of zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one?
zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one has a molecular weight of 295.59 g/mol, XLogP of 2.46, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;bis(difluoromethane);1,3-dimethyl-1,3-diazinan-2-one is sourced from PubChem (CID 166438573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).