C13H23NO2 — CID 166438597
(3R,4S)-1-tert-butyl-4-cyclohexyl-3-hydroxyazetidin-2-one (PubChem CID 166438597) has the molecular formula C13H23NO2 and a molecular weight of 225.33 g/mol. Its IUPAC name is (3R,4S)-1-tert-butyl-4-cyclohexyl-3-hydroxyazetidin-2-one.
| Compound Name | (3R,4S)-1-tert-butyl-4-cyclohexyl-3-hydroxyazetidin-2-one |
|---|---|
| PubChem CID | 166438597 |
| Molecular Formula | C13H23NO2 |
| Molecular Weight | 225.33 g/mol |
| Exact Mass | 225.17 |
| IUPAC Name | (3R,4S)-1-tert-butyl-4-cyclohexyl-3-hydroxyazetidin-2-one |
| SMILES | CC(C)(C)N1C(=O)[C@H](O)[C@@H]1C1CCCCC1 |
| InChI | InChI=1S/C13H23NO2/c1-13(2,3)14-10(11(15)12(14)16)9-7-5-4-6-8-9/h9-11,15H,4-8H2,1-3H3/t10-,11+/m0/s1 |
| InChIKey | KTMPXMUJPSGMSE-WDEREUQCSA-N |
| XLogP | 1.94 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.33 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |