C16H26ClNO4 — CID 166438692
ethyl (2S,3S)-2-amino-3-hydroxy-7-phenylmethoxyheptanoate;hydrochloride (PubChem CID 166438692) has the molecular formula C16H26ClNO4 and a molecular weight of 331.84 g/mol. Its IUPAC name is ethyl (2S,3S)-2-amino-3-hydroxy-7-phenylmethoxyheptanoate;hydrochloride.
| Compound Name | ethyl (2S,3S)-2-amino-3-hydroxy-7-phenylmethoxyheptanoate;hydrochloride |
|---|---|
| PubChem CID | 166438692 |
| Molecular Formula | C16H26ClNO4 |
| Molecular Weight | 331.84 g/mol |
| Exact Mass | 331.16 |
| IUPAC Name | ethyl (2S,3S)-2-amino-3-hydroxy-7-phenylmethoxyheptanoate;hydrochloride |
| SMILES | CCOC(=O)[C@@H](N)[C@@H](O)CCCCOCc1ccccc1.Cl |
| InChI | InChI=1S/C16H25NO4.ClH/c1-2-21-16(19)15(17)14(18)10-6-7-11-20-12-13-8-4-3-5-9-13;/h3-5,8-9,14-15,18H,2,6-7,10-12,17H2,1H3;1H/t14-,15-;/m0./s1 |
| InChIKey | SCTSQMJNYDEXLM-YYLIZZNMSA-N |
| XLogP | 2.05 |
| TPSA | 81.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.84 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|