C23H23NO2 — CID 166438702
(2R,3R)-N,2-dibenzyl-3-hydroxy-3-phenylpropanamide (PubChem CID 166438702) has the molecular formula C23H23NO2 and a molecular weight of 345.44 g/mol. Its IUPAC name is (2R,3R)-N,2-dibenzyl-3-hydroxy-3-phenylpropanamide.
| Compound Name | (2R,3R)-N,2-dibenzyl-3-hydroxy-3-phenylpropanamide |
|---|---|
| PubChem CID | 166438702 |
| Molecular Formula | C23H23NO2 |
| Molecular Weight | 345.44 g/mol |
| Exact Mass | 345.17 |
| IUPAC Name | (2R,3R)-N,2-dibenzyl-3-hydroxy-3-phenylpropanamide |
| SMILES | O=C(NCc1ccccc1)[C@H](Cc1ccccc1)[C@@H](O)c1ccccc1 |
| InChI | InChI=1S/C23H23NO2/c25-22(20-14-8-3-9-15-20)21(16-18-10-4-1-5-11-18)23(26)24-17-19-12-6-2-7-13-19/h1-15,21-22,25H,16-17H2,(H,24,26)/t21-,22+/m1/s1 |
| InChIKey | IKFATFLNQPOENG-YADHBBJMSA-N |
| XLogP | 3.90 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.44 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |