About [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane
[(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane (PubChem CID 166438808) has the molecular formula C11H18F2
and a molecular weight of 188.26 g/mol. Its IUPAC name is [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane.
Molecular Properties
| Compound Name | [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane |
| PubChem CID | 166438808 |
| Molecular Formula | C11H18F2 |
| Molecular Weight | 188.26 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane |
| SMILES | CC(/C=C/C1CCCCC1)C(F)F |
| InChI | InChI=1S/C11H18F2/c1-9(11(12)13)7-8-10-5-3-2-4-6-10/h7-11H,2-6H2,1H3/b8-7+ |
| InChIKey | MEMSJEDOIVKOKY-BQYQJAHWSA-N |
| XLogP | 4.02 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 188.26 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane?
The IUPAC name of [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane (CID 166438808) is [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane.
What is the SMILES notation for [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane?
The canonical SMILES for [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane is CC(/C=C/C1CCCCC1)C(F)F.
What is the InChIKey of [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane?
The InChIKey is MEMSJEDOIVKOKY-BQYQJAHWSA-N. The full InChI is InChI=1S/C11H18F2/c1-9(11(12)13)7-8-10-5-3-2-4-6-10/h7-11H,2-6H2,1H3/b8-7+.
What are the key properties of [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane?
[(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane has a molecular weight of 188.26 g/mol, XLogP of 4.02, 3 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for [(E)-4,4-difluoro-3-methylbut-1-enyl]cyclohexane is sourced from PubChem (CID 166438808), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).