C25H38F2O4 — CID 166438857
3-methylpentan-3-yl 9-acetyloxy-2,2-difluoro-3-(2-phenylethyl)nonanoate (PubChem CID 166438857) has the molecular formula C25H38F2O4 and a molecular weight of 440.57 g/mol. Its IUPAC name is 3-methylpentan-3-yl 9-acetyloxy-2,2-difluoro-3-(2-phenylethyl)nonanoate.
| Compound Name | 3-methylpentan-3-yl 9-acetyloxy-2,2-difluoro-3-(2-phenylethyl)nonanoate |
|---|---|
| PubChem CID | 166438857 |
| Molecular Formula | C25H38F2O4 |
| Molecular Weight | 440.57 g/mol |
| Exact Mass | 440.27 |
| IUPAC Name | 3-methylpentan-3-yl 9-acetyloxy-2,2-difluoro-3-(2-phenylethyl)nonanoate |
| SMILES | CCC(C)(CC)OC(=O)C(F)(F)C(CCCCCCOC(C)=O)CCc1ccccc1 |
| InChI | InChI=1S/C25H38F2O4/c1-5-24(4,6-2)31-23(29)25(26,27)22(18-17-21-14-10-9-11-15-21)16-12-7-8-13-19-30-20(3)28/h9-11,14-15,22H,5-8,12-13,16-19H2,1-4H3 |
| InChIKey | WDZWAWRZCOLUDX-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.57 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|