About tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate
tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate (PubChem CID 166438955) has the molecular formula C18H25Cl2NO3
and a molecular weight of 374.31 g/mol. Its IUPAC name is tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate.
Molecular Properties
| Compound Name | tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate |
| PubChem CID | 166438955 |
| Molecular Formula | C18H25Cl2NO3 |
| Molecular Weight | 374.31 g/mol |
| Exact Mass | 373.12 |
| IUPAC Name | tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCC([C@H](CO)c2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C18H25Cl2NO3/c1-18(2,3)24-17(23)21-8-6-12(7-9-21)14(11-22)13-4-5-15(19)16(20)10-13/h4-5,10,12,14,22H,6-9,11H2,1-3H3/t14-/m0/s1 |
| InChIKey | ZHZCHPHWIWDXKK-AWEZNQCLSA-N |
| XLogP | 4.72 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 374.31 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate?
The IUPAC name of tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate (CID 166438955) is tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate.
What is the SMILES notation for tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate?
The canonical SMILES for tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate is CC(C)(C)OC(=O)N1CCC([C@H](CO)c2ccc(Cl)c(Cl)c2)CC1.
What is the InChIKey of tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate?
The InChIKey is ZHZCHPHWIWDXKK-AWEZNQCLSA-N. The full InChI is InChI=1S/C18H25Cl2NO3/c1-18(2,3)24-17(23)21-8-6-12(7-9-21)14(11-22)13-4-5-15(19)16(20)10-13/h4-5,10,12,14,22H,6-9,11H2,1-3H3/t14-/m0/s1.
What are the key properties of tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate?
tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate has a molecular weight of 374.31 g/mol, XLogP of 4.72, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl 4-[(1S)-1-(3,4-dichlorophenyl)-2-hydroxyethyl]piperidine-1-carboxylate is sourced from PubChem (CID 166438955), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).