C23H29NO2 — CID 166439077
(2R,3S)-N,2-dibenzyl-3-cyclohexyl-3-hydroxypropanamide (PubChem CID 166439077) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is (2R,3S)-N,2-dibenzyl-3-cyclohexyl-3-hydroxypropanamide.
| Compound Name | (2R,3S)-N,2-dibenzyl-3-cyclohexyl-3-hydroxypropanamide |
|---|---|
| PubChem CID | 166439077 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | (2R,3S)-N,2-dibenzyl-3-cyclohexyl-3-hydroxypropanamide |
| SMILES | O=C(NCc1ccccc1)[C@H](Cc1ccccc1)[C@@H](O)C1CCCCC1 |
| InChI | InChI=1S/C23H29NO2/c25-22(20-14-8-3-9-15-20)21(16-18-10-4-1-5-11-18)23(26)24-17-19-12-6-2-7-13-19/h1-2,4-7,10-13,20-22,25H,3,8-9,14-17H2,(H,24,26)/t21-,22+/m1/s1 |
| InChIKey | ANMXZOUFJSKPGT-YADHBBJMSA-N |
| XLogP | 4.10 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |