C27H45NOSi — CID 166439128
(3R,5S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile (PubChem CID 166439128) has the molecular formula C27H45NOSi and a molecular weight of 427.75 g/mol. Its IUPAC name is (3R,5S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile.
| Compound Name | (3R,5S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
|---|---|
| PubChem CID | 166439128 |
| Molecular Formula | C27H45NOSi |
| Molecular Weight | 427.75 g/mol |
| Exact Mass | 427.33 |
| IUPAC Name | (3R,5S,8R,9S,10R,13S,14S)-3-[tert-butyl(dimethyl)silyl]oxy-5,10,13-trimethyl-1,2,3,4,6,7,8,9,11,12,14,15-dodecahydrocyclopenta[a]phenanthrene-17-carbonitrile |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1CC[C@]2(C)[C@H]3CC[C@]4(C)C(C#N)=CC[C@H]4[C@@H]3CC[C@@]2(C)C1 |
| InChI | InChI=1S/C27H45NOSi/c1-24(2,3)30(7,8)29-20-11-16-27(6)23-13-15-26(5)19(18-28)9-10-22(26)21(23)12-14-25(27,4)17-20/h9,20-23H,10-17H2,1-8H3/t20-,21+,22+,23+,25+,26-,27-/m1/s1 |
| InChIKey | WWLYDZKNUYAZAQ-VWUDIAODSA-N |
| XLogP | 7.87 |
| TPSA | 33.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.75 |
| LogP ≤ 5 | 7.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|