C18H16O2 — CID 166439445
(1R,3aR,8bS)-1-benzyl-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one (PubChem CID 166439445) has the molecular formula C18H16O2 and a molecular weight of 264.32 g/mol. Its IUPAC name is (1R,3aR,8bS)-1-benzyl-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one.
| Compound Name | (1R,3aR,8bS)-1-benzyl-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one |
|---|---|
| PubChem CID | 166439445 |
| Molecular Formula | C18H16O2 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.12 |
| IUPAC Name | (1R,3aR,8bS)-1-benzyl-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one |
| SMILES | O=C1O[C@@H]2Cc3ccccc3[C@@H]2[C@H]1Cc1ccccc1 |
| InChI | InChI=1S/C18H16O2/c19-18-15(10-12-6-2-1-3-7-12)17-14-9-5-4-8-13(14)11-16(17)20-18/h1-9,15-17H,10-11H2/t15-,16-,17-/m1/s1 |
| InChIKey | NPIWSWUWHPMLPI-BRWVUGGUSA-N |
| XLogP | 3.11 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |