About 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile
4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile (PubChem CID 166439451) has the molecular formula C19H16N2O4
and a molecular weight of 336.35 g/mol. Its IUPAC name is 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile.
Molecular Properties
| Compound Name | 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile |
| PubChem CID | 166439451 |
| Molecular Formula | C19H16N2O4 |
| Molecular Weight | 336.35 g/mol |
| Exact Mass | 336.11 |
| IUPAC Name | 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile |
| SMILES | COc1cc(-c2[nH]c3ccccc3c(=O)c2C#N)cc(OC)c1OC |
| InChI | InChI=1S/C19H16N2O4/c1-23-15-8-11(9-16(24-2)19(15)25-3)17-13(10-20)18(22)12-6-4-5-7-14(12)21-17/h4-9H,1-3H3,(H,21,22) |
| InChIKey | KHGLXTJGULCXAQ-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 84.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 336.35 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile?
The IUPAC name of 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile (CID 166439451) is 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile.
What is the SMILES notation for 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile?
The canonical SMILES for 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile is COc1cc(-c2[nH]c3ccccc3c(=O)c2C#N)cc(OC)c1OC.
What is the InChIKey of 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile?
The InChIKey is KHGLXTJGULCXAQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H16N2O4/c1-23-15-8-11(9-16(24-2)19(15)25-3)17-13(10-20)18(22)12-6-4-5-7-14(12)21-17/h4-9H,1-3H3,(H,21,22).
What are the key properties of 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile?
4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile has a molecular weight of 336.35 g/mol, XLogP of 3.09, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-oxo-2-(3,4,5-trimethoxyphenyl)-1H-quinoline-3-carbonitrile is sourced from PubChem (CID 166439451), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).