About 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide
3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide (PubChem CID 166439509) has the molecular formula C14H28N2O4
and a molecular weight of 288.39 g/mol. Its IUPAC name is 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide.
Molecular Properties
| Compound Name | 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide |
| PubChem CID | 166439509 |
| Molecular Formula | C14H28N2O4 |
| Molecular Weight | 288.39 g/mol |
| Exact Mass | 288.20 |
| IUPAC Name | 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide |
| SMILES | COCCC(=O)N[C@H](C)CC[C@@H](C)NC(=O)CCOC |
| InChI | InChI=1S/C14H28N2O4/c1-11(15-13(17)7-9-19-3)5-6-12(2)16-14(18)8-10-20-4/h11-12H,5-10H2,1-4H3,(H,15,17)(H,16,18)/t11-,12-/m1/s1 |
| InChIKey | HJHXZACYPVKUEH-VXGBXAGGSA-N |
| XLogP | 0.85 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.39 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide?
The IUPAC name of 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide (CID 166439509) is 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide.
What is the SMILES notation for 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide?
The canonical SMILES for 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide is COCCC(=O)N[C@H](C)CC[C@@H](C)NC(=O)CCOC.
What is the InChIKey of 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide?
The InChIKey is HJHXZACYPVKUEH-VXGBXAGGSA-N. The full InChI is InChI=1S/C14H28N2O4/c1-11(15-13(17)7-9-19-3)5-6-12(2)16-14(18)8-10-20-4/h11-12H,5-10H2,1-4H3,(H,15,17)(H,16,18)/t11-,12-/m1/s1.
What are the key properties of 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide?
3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide has a molecular weight of 288.39 g/mol, XLogP of 0.85, 11 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-N-[(2R,5R)-5-(3-methoxypropanoylamino)hexan-2-yl]propanamide is sourced from PubChem (CID 166439509), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).