C12H15F3O4 — CID 166439840
dimethyl 2-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)cyclopropane-1,1-dicarboxylate (PubChem CID 166439840) has the molecular formula C12H15F3O4 and a molecular weight of 280.24 g/mol. Its IUPAC name is dimethyl 2-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)cyclopropane-1,1-dicarboxylate.
| Compound Name | dimethyl 2-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)cyclopropane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 166439840 |
| Molecular Formula | C12H15F3O4 |
| Molecular Weight | 280.24 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | dimethyl 2-(1,1,1-trifluoro-3-methylbut-2-en-2-yl)cyclopropane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC1C(=C(C)C)C(F)(F)F |
| InChI | InChI=1S/C12H15F3O4/c1-6(2)8(12(13,14)15)7-5-11(7,9(16)18-3)10(17)19-4/h7H,5H2,1-4H3 |
| InChIKey | DRYPWHXLZWSPHZ-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.24 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|