About 2-benzylguanidine
2-benzylguanidine (PubChem CID 16644) has the molecular formula C8H11N3
and a molecular weight of 149.20 g/mol. Its IUPAC name is 2-benzylguanidine.
Molecular Properties
| Compound Name | 2-benzylguanidine |
| PubChem CID | 16644 |
| Molecular Formula | C8H11N3 |
| Molecular Weight | 149.20 g/mol |
| Exact Mass | 149.10 |
| IUPAC Name | 2-benzylguanidine |
| SMILES | NC(N)=NCc1ccccc1 |
| InChI | InChI=1S/C8H11N3/c9-8(10)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H4,9,10,11) |
| InChIKey | ABSNGNUGFQIDDO-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 64.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.20 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 2-benzylguanidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-benzylguanidine?
The IUPAC name of 2-benzylguanidine (CID 16644) is 2-benzylguanidine.
What is the SMILES notation for 2-benzylguanidine?
The canonical SMILES for 2-benzylguanidine is NC(N)=NCc1ccccc1.
What is the InChIKey of 2-benzylguanidine?
The InChIKey is ABSNGNUGFQIDDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3/c9-8(10)11-6-7-4-2-1-3-5-7/h1-5H,6H2,(H4,9,10,11).
What are the key properties of 2-benzylguanidine?
2-benzylguanidine has a molecular weight of 149.20 g/mol, XLogP of 0.46, 2 rotatable bonds, 2 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-benzylguanidine is sourced from PubChem (CID 16644), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).