C17H14O2 — CID 166440148
(1S,3aR,8bS)-1-phenyl-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one (PubChem CID 166440148) has the molecular formula C17H14O2 and a molecular weight of 250.30 g/mol. Its IUPAC name is (1S,3aR,8bS)-1-phenyl-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one.
| Compound Name | (1S,3aR,8bS)-1-phenyl-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one |
|---|---|
| PubChem CID | 166440148 |
| Molecular Formula | C17H14O2 |
| Molecular Weight | 250.30 g/mol |
| Exact Mass | 250.10 |
| IUPAC Name | (1S,3aR,8bS)-1-phenyl-1,3a,4,8b-tetrahydroindeno[2,1-b]furan-2-one |
| SMILES | O=C1O[C@@H]2Cc3ccccc3[C@@H]2[C@H]1c1ccccc1 |
| InChI | InChI=1S/C17H14O2/c18-17-15(11-6-2-1-3-7-11)16-13-9-5-4-8-12(13)10-14(16)19-17/h1-9,14-16H,10H2/t14-,15-,16+/m1/s1 |
| InChIKey | SFFZOXZDXRJEEV-OAGGEKHMSA-N |
| XLogP | 3.04 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.30 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |