About dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate
dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate (PubChem CID 166440343) has the molecular formula C27H26O6
and a molecular weight of 446.50 g/mol. Its IUPAC name is dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate.
Molecular Properties
| Compound Name | dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate |
| PubChem CID | 166440343 |
| Molecular Formula | C27H26O6 |
| Molecular Weight | 446.50 g/mol |
| Exact Mass | 446.17 |
| IUPAC Name | dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate |
| SMILES | CC(=O)C[C@](O)(C(=O)OCc1ccccc1)[C@H](C(=O)OCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C27H26O6/c1-20(28)17-27(31,26(30)33-19-22-13-7-3-8-14-22)24(23-15-9-4-10-16-23)25(29)32-18-21-11-5-2-6-12-21/h2-16,24,31H,17-19H2,1H3/t24-,27+/m0/s1 |
| InChIKey | UVZADOQBGCQYLM-RPLLCQBOSA-N |
| XLogP | 3.97 |
| TPSA | 89.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 446.50 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate?
The IUPAC name of dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate (CID 166440343) is dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate.
What is the SMILES notation for dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate?
The canonical SMILES for dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate is CC(=O)C[C@](O)(C(=O)OCc1ccccc1)[C@H](C(=O)OCc1ccccc1)c1ccccc1.
What is the InChIKey of dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate?
The InChIKey is UVZADOQBGCQYLM-RPLLCQBOSA-N. The full InChI is InChI=1S/C27H26O6/c1-20(28)17-27(31,26(30)33-19-22-13-7-3-8-14-22)24(23-15-9-4-10-16-23)25(29)32-18-21-11-5-2-6-12-21/h2-16,24,31H,17-19H2,1H3/t24-,27+/m0/s1.
What are the key properties of dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate?
dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate has a molecular weight of 446.50 g/mol, XLogP of 3.97, 10 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for dibenzyl (2R,3R)-2-hydroxy-2-(2-oxopropyl)-3-phenylbutanedioate is sourced from PubChem (CID 166440343), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).