C23H25N3O6 — CID 166440382
(1R,2S,3S,4S,5S)-3-cyclohexyl-2-hydroxy-4-nitro-5-(4-nitrophenyl)-2-pyridin-2-ylcyclopentane-1-carbaldehyde (PubChem CID 166440382) has the molecular formula C23H25N3O6 and a molecular weight of 439.47 g/mol. Its IUPAC name is (1R,2S,3S,4S,5S)-3-cyclohexyl-2-hydroxy-4-nitro-5-(4-nitrophenyl)-2-pyridin-2-ylcyclopentane-1-carbaldehyde.
| Compound Name | (1R,2S,3S,4S,5S)-3-cyclohexyl-2-hydroxy-4-nitro-5-(4-nitrophenyl)-2-pyridin-2-ylcyclopentane-1-carbaldehyde |
|---|---|
| PubChem CID | 166440382 |
| Molecular Formula | C23H25N3O6 |
| Molecular Weight | 439.47 g/mol |
| Exact Mass | 439.17 |
| IUPAC Name | (1R,2S,3S,4S,5S)-3-cyclohexyl-2-hydroxy-4-nitro-5-(4-nitrophenyl)-2-pyridin-2-ylcyclopentane-1-carbaldehyde |
| SMILES | O=C[C@@H]1[C@@H](c2ccc([N+](=O)[O-])cc2)[C@H]([N+](=O)[O-])[C@H](C2CCCCC2)[C@@]1(O)c1ccccn1 |
| InChI | InChI=1S/C23H25N3O6/c27-14-18-20(15-9-11-17(12-10-15)25(29)30)22(26(31)32)21(16-6-2-1-3-7-16)23(18,28)19-8-4-5-13-24-19/h4-5,8-14,16,18,20-22,28H,1-3,6-7H2/t18-,20-,21+,22+,23+/m1/s1 |
| InChIKey | SXRLDDFSJMSXMZ-HMWDHGCWSA-N |
| XLogP | 3.63 |
| TPSA | 136.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.47 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|