C18H28O4Si — CID 166440579
ethyl (1R,4S,5S,6S,13S)-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.4.1.04,13]tridec-7-ene-5-carboxylate (PubChem CID 166440579) has the molecular formula C18H28O4Si and a molecular weight of 336.50 g/mol. Its IUPAC name is ethyl (1R,4S,5S,6S,13S)-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.4.1.04,13]tridec-7-ene-5-carboxylate.
| Compound Name | ethyl (1R,4S,5S,6S,13S)-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.4.1.04,13]tridec-7-ene-5-carboxylate |
|---|---|
| PubChem CID | 166440579 |
| Molecular Formula | C18H28O4Si |
| Molecular Weight | 336.50 g/mol |
| Exact Mass | 336.18 |
| IUPAC Name | ethyl (1R,4S,5S,6S,13S)-3-oxo-6-trimethylsilyl-2-oxatricyclo[6.4.1.04,13]tridec-7-ene-5-carboxylate |
| SMILES | CCOC(=O)[C@@H]1[C@H]2C(=O)O[C@@H]3CCCCC(=C[C@@H]1[Si](C)(C)C)[C@H]23 |
| InChI | InChI=1S/C18H28O4Si/c1-5-21-17(19)15-13(23(2,3)4)10-11-8-6-7-9-12-14(11)16(15)18(20)22-12/h10,12-16H,5-9H2,1-4H3/t12-,13+,14+,15+,16+/m1/s1 |
| InChIKey | ZRIBHIJAYXMHKF-YXMSTPNBSA-N |
| XLogP | 3.55 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|