C23H17F12N3O2 — CID 166440607
[(2S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]heptyl] 1,5-dimethylindole-3-carboxylate (PubChem CID 166440607) has the molecular formula C23H17F12N3O2 and a molecular weight of 595.38 g/mol. Its IUPAC name is [(2S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]heptyl] 1,5-dimethylindole-3-carboxylate.
| Compound Name | [(2S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]heptyl] 1,5-dimethylindole-3-carboxylate |
|---|---|
| PubChem CID | 166440607 |
| Molecular Formula | C23H17F12N3O2 |
| Molecular Weight | 595.38 g/mol |
| Exact Mass | 595.11 |
| IUPAC Name | [(2S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]heptyl] 1,5-dimethylindole-3-carboxylate |
| SMILES | Cc1ccc2c(c1)c(C(=O)OC[C@@H](CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cnc(C(F)(F)F)nc1)cn2C |
| InChI | InChI=1S/C23H17F12N3O2/c1-11-3-4-16-14(5-11)15(9-38(16)2)17(39)40-10-12(13-7-36-18(37-8-13)20(26,27)28)6-19(24,25)21(29,30)22(31,32)23(33,34)35/h3-5,7-9,12H,6,10H2,1-2H3/t12-/m1/s1 |
| InChIKey | FSZIKCLRCXTHEK-GFCCVEGCSA-N |
| XLogP | 7.09 |
| TPSA | 57.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 595.38 |
| LogP ≤ 5 | 7.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|