C19H12F12N2O2 — CID 166440608
[(2S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]heptyl] benzoate (PubChem CID 166440608) has the molecular formula C19H12F12N2O2 and a molecular weight of 528.29 g/mol. Its IUPAC name is [(2S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]heptyl] benzoate.
| Compound Name | [(2S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]heptyl] benzoate |
|---|---|
| PubChem CID | 166440608 |
| Molecular Formula | C19H12F12N2O2 |
| Molecular Weight | 528.29 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | [(2S)-4,4,5,5,6,6,7,7,7-nonafluoro-2-[2-(trifluoromethyl)pyrimidin-5-yl]heptyl] benzoate |
| SMILES | O=C(OC[C@@H](CC(F)(F)C(F)(F)C(F)(F)C(F)(F)F)c1cnc(C(F)(F)F)nc1)c1ccccc1 |
| InChI | InChI=1S/C19H12F12N2O2/c20-15(21,17(25,26)18(27,28)19(29,30)31)6-11(9-35-13(34)10-4-2-1-3-5-10)12-7-32-14(33-8-12)16(22,23)24/h1-5,7-8,11H,6,9H2/t11-/m1/s1 |
| InChIKey | UKFITFSVNWEMMK-LLVKDONJSA-N |
| XLogP | 6.29 |
| TPSA | 52.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.29 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|