About 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane]
3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane] (PubChem CID 166440626) has the molecular formula C14H14F2S
and a molecular weight of 252.33 g/mol. Its IUPAC name is 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane].
Molecular Properties
| Compound Name | 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane] |
| PubChem CID | 166440626 |
| Molecular Formula | C14H14F2S |
| Molecular Weight | 252.33 g/mol |
| Exact Mass | 252.08 |
| IUPAC Name | 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane] |
| SMILES | FC(F)=CC1c2ccccc2SC12CCCC2 |
| InChI | InChI=1S/C14H14F2S/c15-13(16)9-11-10-5-1-2-6-12(10)17-14(11)7-3-4-8-14/h1-2,5-6,9,11H,3-4,7-8H2 |
| InChIKey | PBVFPFDEXHUTHI-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.33 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane]?
The IUPAC name of 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane] (CID 166440626) is 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane].
What is the SMILES notation for 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane]?
The canonical SMILES for 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane] is FC(F)=CC1c2ccccc2SC12CCCC2.
What is the InChIKey of 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane]?
The InChIKey is PBVFPFDEXHUTHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14F2S/c15-13(16)9-11-10-5-1-2-6-12(10)17-14(11)7-3-4-8-14/h1-2,5-6,9,11H,3-4,7-8H2.
What are the key properties of 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane]?
3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane] has a molecular weight of 252.33 g/mol, XLogP of 4.97, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2,2-difluoroethenyl)spiro[3H-1-benzothiophene-2,1'-cyclopentane] is sourced from PubChem (CID 166440626), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).