C18H30FNO6 — CID 166440740
diethyl 2-[1-[(4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]ethyl]propanedioate (PubChem CID 166440740) has the molecular formula C18H30FNO6 and a molecular weight of 375.44 g/mol. Its IUPAC name is diethyl 2-[1-[(4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]ethyl]propanedioate.
| Compound Name | diethyl 2-[1-[(4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]ethyl]propanedioate |
|---|---|
| PubChem CID | 166440740 |
| Molecular Formula | C18H30FNO6 |
| Molecular Weight | 375.44 g/mol |
| Exact Mass | 375.21 |
| IUPAC Name | diethyl 2-[1-[(4S)-4-fluoro-1-[(2-methylpropan-2-yl)oxycarbonyl]pyrrolidin-2-yl]ethyl]propanedioate |
| SMILES | CCOC(=O)C(C(=O)OCC)C(C)C1C[C@H](F)CN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C18H30FNO6/c1-7-24-15(21)14(16(22)25-8-2)11(3)13-9-12(19)10-20(13)17(23)26-18(4,5)6/h11-14H,7-10H2,1-6H3/t11?,12-,13?/m0/s1 |
| InChIKey | IVRQDHXIOQHHNT-CPCZMJQVSA-N |
| XLogP | 2.71 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.44 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|