C20H17F5N3O+ — CID 166440768
5-benzyl-6,6-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium (PubChem CID 166440768) has the molecular formula C20H17F5N3O+ and a molecular weight of 410.37 g/mol. Its IUPAC name is 5-benzyl-6,6-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium.
| Compound Name | 5-benzyl-6,6-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
|---|---|
| PubChem CID | 166440768 |
| Molecular Formula | C20H17F5N3O+ |
| Molecular Weight | 410.37 g/mol |
| Exact Mass | 410.13 |
| IUPAC Name | 5-benzyl-6,6-dimethyl-2-(2,3,4,5,6-pentafluorophenyl)-5,8-dihydro-[1,2,4]triazolo[3,4-c][1,4]oxazin-4-ium |
| SMILES | CC1(C)OCc2nn(-c3c(F)c(F)c(F)c(F)c3F)c[n+]2C1Cc1ccccc1 |
| InChI | InChI=1S/C20H17F5N3O/c1-20(2)12(8-11-6-4-3-5-7-11)27-10-28(26-13(27)9-29-20)19-17(24)15(22)14(21)16(23)18(19)25/h3-7,10,12H,8-9H2,1-2H3/q+1 |
| InChIKey | XZDCUZYZDMCSFH-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.37 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|