About tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate
tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate (PubChem CID 166440908) has the molecular formula C18H27N2O2+
and a molecular weight of 303.43 g/mol. Its IUPAC name is tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate.
Molecular Properties
| Compound Name | tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate |
| PubChem CID | 166440908 |
| Molecular Formula | C18H27N2O2+ |
| Molecular Weight | 303.43 g/mol |
| Exact Mass | 303.21 |
| IUPAC Name | tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate |
| SMILES | CC[N+]1=C(C)C(C)(C)c2cc(NC(=O)OC(C)(C)C)ccc21 |
| InChI | InChI=1S/C18H26N2O2/c1-8-20-12(2)18(6,7)14-11-13(9-10-15(14)20)19-16(21)22-17(3,4)5/h9-11H,8H2,1-7H3/p+1 |
| InChIKey | WLFCQBPKDGUSLN-UHFFFAOYSA-O |
| XLogP | 4.45 |
| TPSA | 41.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 303.43 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate?
The IUPAC name of tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate (CID 166440908) is tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate.
What is the SMILES notation for tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate?
The canonical SMILES for tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate is CC[N+]1=C(C)C(C)(C)c2cc(NC(=O)OC(C)(C)C)ccc21.
What is the InChIKey of tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate?
The InChIKey is WLFCQBPKDGUSLN-UHFFFAOYSA-O. The full InChI is InChI=1S/C18H26N2O2/c1-8-20-12(2)18(6,7)14-11-13(9-10-15(14)20)19-16(21)22-17(3,4)5/h9-11H,8H2,1-7H3/p+1.
What are the key properties of tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate?
tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate has a molecular weight of 303.43 g/mol, XLogP of 4.45, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl N-(1-ethyl-2,3,3-trimethylindol-1-ium-5-yl)carbamate is sourced from PubChem (CID 166440908), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).