About (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one
(5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one (PubChem CID 166440990) has the molecular formula C12H19IO2Si
and a molecular weight of 350.27 g/mol. Its IUPAC name is (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one |
| PubChem CID | 166440990 |
| Molecular Formula | C12H19IO2Si |
| Molecular Weight | 350.27 g/mol |
| Exact Mass | 350.02 |
| IUPAC Name | (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one |
| SMILES | CC1=CC(=O)[C@H]([C@@H](/C=C\I)O[Si](C)(C)C)C1 |
| InChI | InChI=1S/C12H19IO2Si/c1-9-7-10(11(14)8-9)12(5-6-13)15-16(2,3)4/h5-6,8,10,12H,7H2,1-4H3/b6-5-/t10-,12-/m1/s1 |
| InChIKey | IPBNQMLPLUXZPP-FNSKHJIESA-N |
| XLogP | 3.69 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 350.27 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one?
The IUPAC name of (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one (CID 166440990) is (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one.
What is the SMILES notation for (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one?
The canonical SMILES for (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one is CC1=CC(=O)[C@H]([C@@H](/C=C\I)O[Si](C)(C)C)C1.
What is the InChIKey of (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one?
The InChIKey is IPBNQMLPLUXZPP-FNSKHJIESA-N. The full InChI is InChI=1S/C12H19IO2Si/c1-9-7-10(11(14)8-9)12(5-6-13)15-16(2,3)4/h5-6,8,10,12H,7H2,1-4H3/b6-5-/t10-,12-/m1/s1.
What are the key properties of (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one?
(5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one has a molecular weight of 350.27 g/mol, XLogP of 3.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (5S)-5-[(Z,1S)-3-iodo-1-trimethylsilyloxyprop-2-enyl]-3-methylcyclopent-2-en-1-one is sourced from PubChem (CID 166440990), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).