About [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane
[2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane (PubChem CID 166441106) has the molecular formula C11H15F5S
and a molecular weight of 274.30 g/mol. Its IUPAC name is [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane.
Molecular Properties
| Compound Name | [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane |
| PubChem CID | 166441106 |
| Molecular Formula | C11H15F5S |
| Molecular Weight | 274.30 g/mol |
| Exact Mass | 274.08 |
| IUPAC Name | [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane |
| SMILES | C=C(SC(F)(F)F)C(F)(F)CC1CCCCC1 |
| InChI | InChI=1S/C11H15F5S/c1-8(17-11(14,15)16)10(12,13)7-9-5-3-2-4-6-9/h9H,1-7H2 |
| InChIKey | SPMCDIMSGLOKKE-UHFFFAOYSA-N |
| XLogP | 5.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 274.30 |
| LogP ≤ 5 | 5.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane?
The IUPAC name of [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane (CID 166441106) is [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane.
What is the SMILES notation for [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane?
The canonical SMILES for [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane is C=C(SC(F)(F)F)C(F)(F)CC1CCCCC1.
What is the InChIKey of [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane?
The InChIKey is SPMCDIMSGLOKKE-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15F5S/c1-8(17-11(14,15)16)10(12,13)7-9-5-3-2-4-6-9/h9H,1-7H2.
What are the key properties of [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane?
[2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane has a molecular weight of 274.30 g/mol, XLogP of 5.36, 4 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for [2,2-difluoro-3-(trifluoromethylsulfanyl)but-3-enyl]cyclohexane is sourced from PubChem (CID 166441106), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).