About (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione
(5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione (PubChem CID 166441273) has the molecular formula C20H14FNO3
and a molecular weight of 335.33 g/mol. Its IUPAC name is (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione.
Molecular Properties
| Compound Name | (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione |
| PubChem CID | 166441273 |
| Molecular Formula | C20H14FNO3 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.10 |
| IUPAC Name | (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione |
| SMILES | C=CCN1C(=O)[C@]2(OC(=O)C=C2c2ccccc2)c2cc(F)ccc21 |
| InChI | InChI=1S/C20H14FNO3/c1-2-10-22-17-9-8-14(21)11-16(17)20(19(22)24)15(12-18(23)25-20)13-6-4-3-5-7-13/h2-9,11-12H,1,10H2/t20-/m1/s1 |
| InChIKey | OOOPIUMBBSAZHW-HXUWFJFHSA-N |
| XLogP | 3.19 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione?
The IUPAC name of (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione (CID 166441273) is (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione.
What is the SMILES notation for (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione?
The canonical SMILES for (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione is C=CCN1C(=O)[C@]2(OC(=O)C=C2c2ccccc2)c2cc(F)ccc21.
What is the InChIKey of (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione?
The InChIKey is OOOPIUMBBSAZHW-HXUWFJFHSA-N. The full InChI is InChI=1S/C20H14FNO3/c1-2-10-22-17-9-8-14(21)11-16(17)20(19(22)24)15(12-18(23)25-20)13-6-4-3-5-7-13/h2-9,11-12H,1,10H2/t20-/m1/s1.
What are the key properties of (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione?
(5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione has a molecular weight of 335.33 g/mol, XLogP of 3.19, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5R)-5'-fluoro-4-phenyl-1'-prop-2-enylspiro[furan-5,3'-indole]-2,2'-dione is sourced from PubChem (CID 166441273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).