C21H23F3O4 — CID 166441396
dimethyl 3,3-dimethyl-4-(1,1,1-trifluoro-4-phenylbut-3-yn-2-yl)cyclopentane-1,1-dicarboxylate (PubChem CID 166441396) has the molecular formula C21H23F3O4 and a molecular weight of 396.41 g/mol. Its IUPAC name is dimethyl 3,3-dimethyl-4-(1,1,1-trifluoro-4-phenylbut-3-yn-2-yl)cyclopentane-1,1-dicarboxylate.
| Compound Name | dimethyl 3,3-dimethyl-4-(1,1,1-trifluoro-4-phenylbut-3-yn-2-yl)cyclopentane-1,1-dicarboxylate |
|---|---|
| PubChem CID | 166441396 |
| Molecular Formula | C21H23F3O4 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.15 |
| IUPAC Name | dimethyl 3,3-dimethyl-4-(1,1,1-trifluoro-4-phenylbut-3-yn-2-yl)cyclopentane-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)CC(C(C#Cc2ccccc2)C(F)(F)F)C(C)(C)C1 |
| InChI | InChI=1S/C21H23F3O4/c1-19(2)13-20(17(25)27-3,18(26)28-4)12-16(19)15(21(22,23)24)11-10-14-8-6-5-7-9-14/h5-9,15-16H,12-13H2,1-4H3 |
| InChIKey | TVBINFFBHHNMSU-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|