C20H14F6O — CID 166441475
2-methyl-4-phenyl-2-(2,2,2-trifluoroethyl)-1-[4-(trifluoromethyl)phenyl]but-3-yn-1-one (PubChem CID 166441475) has the molecular formula C20H14F6O and a molecular weight of 384.32 g/mol. Its IUPAC name is 2-methyl-4-phenyl-2-(2,2,2-trifluoroethyl)-1-[4-(trifluoromethyl)phenyl]but-3-yn-1-one.
| Compound Name | 2-methyl-4-phenyl-2-(2,2,2-trifluoroethyl)-1-[4-(trifluoromethyl)phenyl]but-3-yn-1-one |
|---|---|
| PubChem CID | 166441475 |
| Molecular Formula | C20H14F6O |
| Molecular Weight | 384.32 g/mol |
| Exact Mass | 384.09 |
| IUPAC Name | 2-methyl-4-phenyl-2-(2,2,2-trifluoroethyl)-1-[4-(trifluoromethyl)phenyl]but-3-yn-1-one |
| SMILES | CC(C#Cc1ccccc1)(CC(F)(F)F)C(=O)c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C20H14F6O/c1-18(13-19(21,22)23,12-11-14-5-3-2-4-6-14)17(27)15-7-9-16(10-8-15)20(24,25)26/h2-10H,13H2,1H3 |
| InChIKey | ZFEUBTVEBDLXHC-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.32 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|