About 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole
5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole (PubChem CID 166441499) has the molecular formula C12H7N3O2S2
and a molecular weight of 289.34 g/mol. Its IUPAC name is 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole.
Molecular Properties
| Compound Name | 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole |
| PubChem CID | 166441499 |
| Molecular Formula | C12H7N3O2S2 |
| Molecular Weight | 289.34 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole |
| SMILES | O=[N+]([O-])c1ccc(Sc2ccc3nsnc3c2)cc1 |
| InChI | InChI=1S/C12H7N3O2S2/c16-15(17)8-1-3-9(4-2-8)18-10-5-6-11-12(7-10)14-19-13-11/h1-7H |
| InChIKey | CLKSCKVKCBQXSH-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 68.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 289.34 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole?
The IUPAC name of 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole (CID 166441499) is 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole.
What is the SMILES notation for 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole?
The canonical SMILES for 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole is O=[N+]([O-])c1ccc(Sc2ccc3nsnc3c2)cc1.
What is the InChIKey of 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole?
The InChIKey is CLKSCKVKCBQXSH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H7N3O2S2/c16-15(17)8-1-3-9(4-2-8)18-10-5-6-11-12(7-10)14-19-13-11/h1-7H.
What are the key properties of 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole?
5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole has a molecular weight of 289.34 g/mol, XLogP of 3.75, 3 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-nitrophenyl)sulfanyl-2,1,3-benzothiadiazole is sourced from PubChem (CID 166441499), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).