C30H41N5O10 — CID 166441637
tert-butyl N-[3,3-dimethoxy-2-oxo-1-[[1-[[(1R,2S,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indol-5-yl]carbamate (PubChem CID 166441637) has the molecular formula C30H41N5O10 and a molecular weight of 631.68 g/mol. Its IUPAC name is tert-butyl N-[3,3-dimethoxy-2-oxo-1-[[1-[[(1R,2S,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indol-5-yl]carbamate.
| Compound Name | tert-butyl N-[3,3-dimethoxy-2-oxo-1-[[1-[[(1R,2S,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indol-5-yl]carbamate |
|---|---|
| PubChem CID | 166441637 |
| Molecular Formula | C30H41N5O10 |
| Molecular Weight | 631.68 g/mol |
| Exact Mass | 631.29 |
| IUPAC Name | tert-butyl N-[3,3-dimethoxy-2-oxo-1-[[1-[[(1R,2S,6S,8R,9R)-4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecan-8-yl]methyl]triazol-4-yl]methyl]indol-5-yl]carbamate |
| SMILES | COC1(OC)C(=O)N(Cc2cn(C[C@H]3O[C@H]4OC(C)(C)O[C@H]4[C@@H]4OC(C)(C)O[C@@H]43)nn2)c2ccc(NC(=O)OC(C)(C)C)cc21 |
| InChI | InChI=1S/C30H41N5O10/c1-27(2,3)45-26(37)31-16-10-11-19-18(12-16)30(38-8,39-9)25(36)35(19)14-17-13-34(33-32-17)15-20-21-22(42-28(4,5)41-21)23-24(40-20)44-29(6,7)43-23/h10-13,20-24H,14-15H2,1-9H3,(H,31,37)/t20-,21-,22-,23+,24+/m1/s1 |
| InChIKey | KQBOBASPUMJLNR-VDLPQLTJSA-N |
| XLogP | 3.01 |
| TPSA | 153.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 631.68 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|