C17H22ClNO2 — CID 166441648
methyl (3R,4S,5E)-1-benzyl-3-chloro-2,3,4,7,8,9-hexahydroazonine-4-carboxylate (PubChem CID 166441648) has the molecular formula C17H22ClNO2 and a molecular weight of 307.82 g/mol. Its IUPAC name is methyl (3R,4S,5E)-1-benzyl-3-chloro-2,3,4,7,8,9-hexahydroazonine-4-carboxylate.
| Compound Name | methyl (3R,4S,5E)-1-benzyl-3-chloro-2,3,4,7,8,9-hexahydroazonine-4-carboxylate |
|---|---|
| PubChem CID | 166441648 |
| Molecular Formula | C17H22ClNO2 |
| Molecular Weight | 307.82 g/mol |
| Exact Mass | 307.13 |
| IUPAC Name | methyl (3R,4S,5E)-1-benzyl-3-chloro-2,3,4,7,8,9-hexahydroazonine-4-carboxylate |
| SMILES | COC(=O)[C@@H]1/C=C/CCCN(Cc2ccccc2)C[C@@H]1Cl |
| InChI | InChI=1S/C17H22ClNO2/c1-21-17(20)15-10-6-3-7-11-19(13-16(15)18)12-14-8-4-2-5-9-14/h2,4-6,8-10,15-16H,3,7,11-13H2,1H3/b10-6+/t15-,16+/m1/s1 |
| InChIKey | QGXODRYXFCRYHY-ZLAMNEIASA-N |
| XLogP | 3.24 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.82 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|