C16H22O4 — CID 166441726
(1R,4S,6R,7S,9R,10R,13R)-10-methoxy-5,5,9-trimethyl-3-oxatetracyclo[5.5.1.01,6.04,13]tridecane-2,8-dione (PubChem CID 166441726) has the molecular formula C16H22O4 and a molecular weight of 278.35 g/mol. Its IUPAC name is (1R,4S,6R,7S,9R,10R,13R)-10-methoxy-5,5,9-trimethyl-3-oxatetracyclo[5.5.1.01,6.04,13]tridecane-2,8-dione.
| Compound Name | (1R,4S,6R,7S,9R,10R,13R)-10-methoxy-5,5,9-trimethyl-3-oxatetracyclo[5.5.1.01,6.04,13]tridecane-2,8-dione |
|---|---|
| PubChem CID | 166441726 |
| Molecular Formula | C16H22O4 |
| Molecular Weight | 278.35 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | (1R,4S,6R,7S,9R,10R,13R)-10-methoxy-5,5,9-trimethyl-3-oxatetracyclo[5.5.1.01,6.04,13]tridecane-2,8-dione |
| SMILES | CO[C@@H]1CC[C@]23C(=O)O[C@H]4[C@@H]2[C@@H](C(=O)[C@@H]1C)[C@@H]3C4(C)C |
| InChI | InChI=1S/C16H22O4/c1-7-8(19-4)5-6-16-10-9(11(7)17)12(16)15(2,3)13(10)20-14(16)18/h7-10,12-13H,5-6H2,1-4H3/t7-,8-,9+,10+,12-,13+,16+/m1/s1 |
| InChIKey | QFBHCJAQSZGFLR-PMUVVLJNSA-N |
| XLogP | 1.81 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.35 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |