C18H26O2 — CID 166441727
(3aR,8S,9R,9aS,9bR)-9-but-3-enyl-8-methyl-3,3a,5,6,6a,7,8,9,9a,9b-decahydro-2H-phenalene-1,4-dione (PubChem CID 166441727) has the molecular formula C18H26O2 and a molecular weight of 274.40 g/mol. Its IUPAC name is (3aR,8S,9R,9aS,9bR)-9-but-3-enyl-8-methyl-3,3a,5,6,6a,7,8,9,9a,9b-decahydro-2H-phenalene-1,4-dione.
| Compound Name | (3aR,8S,9R,9aS,9bR)-9-but-3-enyl-8-methyl-3,3a,5,6,6a,7,8,9,9a,9b-decahydro-2H-phenalene-1,4-dione |
|---|---|
| PubChem CID | 166441727 |
| Molecular Formula | C18H26O2 |
| Molecular Weight | 274.40 g/mol |
| Exact Mass | 274.19 |
| IUPAC Name | (3aR,8S,9R,9aS,9bR)-9-but-3-enyl-8-methyl-3,3a,5,6,6a,7,8,9,9a,9b-decahydro-2H-phenalene-1,4-dione |
| SMILES | C=CCC[C@H]1[C@@H]2C(=O)CC[C@H]3C(=O)CCC(C[C@@H]1C)[C@@H]23 |
| InChI | InChI=1S/C18H26O2/c1-3-4-5-13-11(2)10-12-6-8-15(19)14-7-9-16(20)18(13)17(12)14/h3,11-14,17-18H,1,4-10H2,2H3/t11-,12?,13+,14-,17+,18+/m0/s1 |
| InChIKey | MMFWMVBNASJBQX-SQROORHGSA-N |
| XLogP | 3.80 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.40 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|