C18H29NO9 — CID 166441797
diethyl 2-[[(2R,3S,4R)-2,4-diacetyloxy-3-methylpentanoyl]amino]-2-methylpropanedioate (PubChem CID 166441797) has the molecular formula C18H29NO9 and a molecular weight of 403.43 g/mol. Its IUPAC name is diethyl 2-[[(2R,3S,4R)-2,4-diacetyloxy-3-methylpentanoyl]amino]-2-methylpropanedioate.
| Compound Name | diethyl 2-[[(2R,3S,4R)-2,4-diacetyloxy-3-methylpentanoyl]amino]-2-methylpropanedioate |
|---|---|
| PubChem CID | 166441797 |
| Molecular Formula | C18H29NO9 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.18 |
| IUPAC Name | diethyl 2-[[(2R,3S,4R)-2,4-diacetyloxy-3-methylpentanoyl]amino]-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(NC(=O)[C@H](OC(C)=O)[C@@H](C)[C@@H](C)OC(C)=O)C(=O)OCC |
| InChI | InChI=1S/C18H29NO9/c1-8-25-16(23)18(7,17(24)26-9-2)19-15(22)14(28-13(6)21)10(3)11(4)27-12(5)20/h10-11,14H,8-9H2,1-7H3,(H,19,22)/t10-,11+,14+/m0/s1 |
| InChIKey | ZUWDYUQJFFNKNB-MISXGVKJSA-N |
| XLogP | 0.51 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|