C31H36O3 — CID 166441814
trans-ethyl (1R,2R)-3-[(8R,9S,13S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-2-phenylcyclobutane-1-carboxylate (PubChem CID 166441814) has the molecular formula C31H36O3 and a molecular weight of 456.63 g/mol. Its IUPAC name is trans-ethyl (1R,2R)-3-[(8R,9S,13S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-2-phenylcyclobutane-1-carboxylate.
| Compound Name | trans-ethyl (1R,2R)-3-[(8R,9S,13S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-2-phenylcyclobutane-1-carboxylate |
|---|---|
| PubChem CID | 166441814 |
| Molecular Formula | C31H36O3 |
| Molecular Weight | 456.63 g/mol |
| Exact Mass | 456.27 |
| IUPAC Name | trans-ethyl (1R,2R)-3-[(8R,9S,13S)-13-methyl-17-oxo-7,8,9,11,12,14,15,16-octahydro-6H-cyclopenta[a]phenanthren-3-yl]-2-phenylcyclobutane-1-carboxylate |
| SMILES | CCOC(=O)[C@@H]1CC(c2ccc3c(c2)CC[C@H]2C4CCC(=O)[C@@]4(C)CC[C@H]32)[C@H]1c1ccccc1 |
| InChI | InChI=1S/C31H36O3/c1-3-34-30(33)26-18-25(29(26)19-7-5-4-6-8-19)21-9-11-22-20(17-21)10-12-24-23(22)15-16-31(2)27(24)13-14-28(31)32/h4-9,11,17,23-27,29H,3,10,12-16,18H2,1-2H3/t23-,24-,25?,26-,27?,29-,31+/m1/s1 |
| InChIKey | WCOADVZSENVRHO-RAEOFOSGSA-N |
| XLogP | 6.56 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.63 |
| LogP ≤ 5 | 6.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |