C22H30B2N2O4 — CID 166441900
2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]pyridine (PubChem CID 166441900) has the molecular formula C22H30B2N2O4 and a molecular weight of 408.12 g/mol. Its IUPAC name is 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]pyridine.
| Compound Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]pyridine |
|---|---|
| PubChem CID | 166441900 |
| Molecular Formula | C22H30B2N2O4 |
| Molecular Weight | 408.12 g/mol |
| Exact Mass | 408.24 |
| IUPAC Name | 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-[2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-4-pyridinyl]pyridine |
| SMILES | CC1(C)OB(c2cc(-c3ccnc(B4OC(C)(C)C(C)(C)O4)c3)ccn2)OC1(C)C |
| InChI | InChI=1S/C22H30B2N2O4/c1-19(2)20(3,4)28-23(27-19)17-13-15(9-11-25-17)16-10-12-26-18(14-16)24-29-21(5,6)22(7,8)30-24/h9-14H,1-8H3 |
| InChIKey | JSKFHZVGVZAMAS-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 62.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.12 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|