C20H26 — CID 166442312
(8S,9R,10S,12R)-10-benzyltetracyclo[6.5.0.01,9.010,12]tridecane (PubChem CID 166442312) has the molecular formula C20H26 and a molecular weight of 266.43 g/mol. Its IUPAC name is (8S,9R,10S,12R)-10-benzyltetracyclo[6.5.0.01,9.010,12]tridecane.
| Compound Name | (8S,9R,10S,12R)-10-benzyltetracyclo[6.5.0.01,9.010,12]tridecane |
|---|---|
| PubChem CID | 166442312 |
| Molecular Formula | C20H26 |
| Molecular Weight | 266.43 g/mol |
| Exact Mass | 266.20 |
| IUPAC Name | (8S,9R,10S,12R)-10-benzyltetracyclo[6.5.0.01,9.010,12]tridecane |
| SMILES | c1ccc(C[C@@]23C[C@@H]2CC24CCCCCC[C@H]2[C@H]43)cc1 |
| InChI | InChI=1S/C20H26/c1-2-7-11-19-13-16-14-20(16,18(19)17(19)10-6-1)12-15-8-4-3-5-9-15/h3-5,8-9,16-18H,1-2,6-7,10-14H2/t16-,17-,18+,19?,20+/m0/s1 |
| InChIKey | OCESSDDXTCLJHC-XEOGZFBHSA-N |
| XLogP | 5.23 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.43 |
| LogP ≤ 5 | 5.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |