C27H16ClF2NO — CID 166442732
2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one (PubChem CID 166442732) has the molecular formula C27H16ClF2NO and a molecular weight of 443.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one.
| Compound Name | 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one |
|---|---|
| PubChem CID | 166442732 |
| Molecular Formula | C27H16ClF2NO |
| Molecular Weight | 443.88 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one |
| SMILES | O=c1cc(-c2ccc(Cl)cc2)[nH]c2cc(-c3ccc(F)cc3)cc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C27H16ClF2NO/c28-20-7-1-18(2-8-20)24-15-26(32)27-23(17-5-11-22(30)12-6-17)13-19(14-25(27)31-24)16-3-9-21(29)10-4-16/h1-15H,(H,31,32) |
| InChIKey | TWSRZVZZOACQAL-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.88 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |