About 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one
2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one (PubChem CID 166442732) has the molecular formula C27H16ClF2NO
and a molecular weight of 443.88 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one.
Molecular Properties
| Compound Name | 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one |
| PubChem CID | 166442732 |
| Molecular Formula | C27H16ClF2NO |
| Molecular Weight | 443.88 g/mol |
| Exact Mass | 443.09 |
| IUPAC Name | 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one |
| SMILES | O=c1cc(-c2ccc(Cl)cc2)[nH]c2cc(-c3ccc(F)cc3)cc(-c3ccc(F)cc3)c12 |
| InChI | InChI=1S/C27H16ClF2NO/c28-20-7-1-18(2-8-20)24-15-26(32)27-23(17-5-11-22(30)12-6-17)13-19(14-25(27)31-24)16-3-9-21(29)10-4-16/h1-15H,(H,31,32) |
| InChIKey | TWSRZVZZOACQAL-UHFFFAOYSA-N |
| XLogP | 7.46 |
| TPSA | 32.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 443.88 |
| LogP ≤ 5 | 7.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one?
The IUPAC name of 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one (CID 166442732) is 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one.
What is the SMILES notation for 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one?
The canonical SMILES for 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one is O=c1cc(-c2ccc(Cl)cc2)[nH]c2cc(-c3ccc(F)cc3)cc(-c3ccc(F)cc3)c12.
What is the InChIKey of 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one?
The InChIKey is TWSRZVZZOACQAL-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H16ClF2NO/c28-20-7-1-18(2-8-20)24-15-26(32)27-23(17-5-11-22(30)12-6-17)13-19(14-25(27)31-24)16-3-9-21(29)10-4-16/h1-15H,(H,31,32).
What are the key properties of 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one?
2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one has a molecular weight of 443.88 g/mol, XLogP of 7.46, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(4-chlorophenyl)-5,7-bis(4-fluorophenyl)-1H-quinolin-4-one is sourced from PubChem (CID 166442732), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).