C14H17F3Si — CID 166442758
trimethyl-[(3S)-5,5,5-trifluoro-3-phenylpent-1-ynyl]silane (PubChem CID 166442758) has the molecular formula C14H17F3Si and a molecular weight of 270.37 g/mol. Its IUPAC name is trimethyl-[(3S)-5,5,5-trifluoro-3-phenylpent-1-ynyl]silane.
| Compound Name | trimethyl-[(3S)-5,5,5-trifluoro-3-phenylpent-1-ynyl]silane |
|---|---|
| PubChem CID | 166442758 |
| Molecular Formula | C14H17F3Si |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | trimethyl-[(3S)-5,5,5-trifluoro-3-phenylpent-1-ynyl]silane |
| SMILES | C[Si](C)(C)C#C[C@@H](CC(F)(F)F)c1ccccc1 |
| InChI | InChI=1S/C14H17F3Si/c1-18(2,3)10-9-13(11-14(15,16)17)12-7-5-4-6-8-12/h4-8,13H,11H2,1-3H3/t13-/m0/s1 |
| InChIKey | JZIPSDGWZYAYPN-ZDUSSCGKSA-N |
| XLogP | 4.60 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|